C23H32OS — CID 11760088
[(1R,3aS,3bR,6S,6aS,7aR)-3b,7a-dimethyl-6-phenylsulfanyl-1-propan-2-yl-1,2,3,3a,6,7-hexahydrocyclopenta[a]pentalen-6a-yl]methanol (PubChem CID 11760088) has the molecular formula C23H32OS and a molecular weight of 356.58 g/mol. Its IUPAC name is [(1R,3aS,3bR,6S,6aS,7aR)-3b,7a-dimethyl-6-phenylsulfanyl-1-propan-2-yl-1,2,3,3a,6,7-hexahydrocyclopenta[a]pentalen-6a-yl]methanol.
| Compound Name | [(1R,3aS,3bR,6S,6aS,7aR)-3b,7a-dimethyl-6-phenylsulfanyl-1-propan-2-yl-1,2,3,3a,6,7-hexahydrocyclopenta[a]pentalen-6a-yl]methanol |
|---|---|
| PubChem CID | 11760088 |
| Molecular Formula | C23H32OS |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | [(1R,3aS,3bR,6S,6aS,7aR)-3b,7a-dimethyl-6-phenylsulfanyl-1-propan-2-yl-1,2,3,3a,6,7-hexahydrocyclopenta[a]pentalen-6a-yl]methanol |
| SMILES | CC(C)[C@H]1CC[C@H]2[C@]1(C)C[C@]1(CO)[C@@H](Sc3ccccc3)C=C[C@]21C |
| InChI | InChI=1S/C23H32OS/c1-16(2)18-10-11-19-21(18,3)14-23(15-24)20(12-13-22(19,23)4)25-17-8-6-5-7-9-17/h5-9,12-13,16,18-20,24H,10-11,14-15H2,1-4H3/t18-,19+,20+,21-,22-,23+/m1/s1 |
| InChIKey | MXJLROUXXNWWOK-XNZMWDKWSA-N |
| XLogP | 5.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|