About 3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate
3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate (PubChem CID 11760250) has the molecular formula C18H21NO5S
and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate.
Molecular Properties
| Compound Name | 3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate |
| PubChem CID | 11760250 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate |
| SMILES | CCOS(=O)(=O)[O-].CC[n+]1c(C)oc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C16H16NO.C2H6O4S/c1-3-17-12(2)18-16-10-9-14(11-15(16)17)13-7-5-4-6-8-13;1-2-6-7(3,4)5/h4-11H,3H2,1-2H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | OBYRJRMHXXGCPJ-UHFFFAOYSA-M |
| XLogP | 3.20 |
| TPSA | 83.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate?
The IUPAC name of 3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate (CID 11760250) is 3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate.
What is the SMILES notation for 3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate?
The canonical SMILES for 3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate is CCOS(=O)(=O)[O-].CC[n+]1c(C)oc2ccc(-c3ccccc3)cc21.
What is the InChIKey of 3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate?
The InChIKey is OBYRJRMHXXGCPJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H16NO.C2H6O4S/c1-3-17-12(2)18-16-10-9-14(11-15(16)17)13-7-5-4-6-8-13;1-2-6-7(3,4)5/h4-11H,3H2,1-2H3;2H2,1H3,(H,3,4,5)/q+1;/p-1.
What are the key properties of 3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate?
3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate has a molecular weight of 363.44 g/mol, XLogP of 3.20, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-methyl-5-phenyl-1,3-benzoxazol-3-ium;ethyl sulfate is sourced from PubChem (CID 11760250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).