C21H36O3Si — CID 11760284
ethyl (1R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-methylidene-3,5,6,7,8,8a-hexahydronaphthalene-1-carboxylate (PubChem CID 11760284) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is ethyl (1R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-methylidene-3,5,6,7,8,8a-hexahydronaphthalene-1-carboxylate.
| Compound Name | ethyl (1R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-methylidene-3,5,6,7,8,8a-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11760284 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | ethyl (1R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-methylidene-3,5,6,7,8,8a-hexahydronaphthalene-1-carboxylate |
| SMILES | C=C1CC(O[Si](C)(C)C(C)(C)C)=C2CCCC[C@@H]2[C@@]1(C)C(=O)OCC |
| InChI | InChI=1S/C21H36O3Si/c1-9-23-19(22)21(6)15(2)14-18(16-12-10-11-13-17(16)21)24-25(7,8)20(3,4)5/h17H,2,9-14H2,1,3-8H3/t17-,21-/m0/s1 |
| InChIKey | REOUAGPJVAPLTO-UWJYYQICSA-N |
| XLogP | 5.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|