C20H22N4O3 — CID 11760316
(1R,2S,3R,4R,5R)-3-azido-N-benzyl-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-amine (PubChem CID 11760316) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is (1R,2S,3R,4R,5R)-3-azido-N-benzyl-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-amine.
| Compound Name | (1R,2S,3R,4R,5R)-3-azido-N-benzyl-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-amine |
|---|---|
| PubChem CID | 11760316 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (1R,2S,3R,4R,5R)-3-azido-N-benzyl-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-4-amine |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H](NCc2ccccc2)[C@@H]2OC[C@@H](O2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H22N4O3/c21-24-23-17-18(22-11-14-7-3-1-4-8-14)20-26-13-16(27-20)19(17)25-12-15-9-5-2-6-10-15/h1-10,16-20,22H,11-13H2/t16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | URSPNTMVALSMTM-LASHMREHSA-N |
| XLogP | 3.16 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|