C14H29IOSi — CID 11760361
(3S,5S)-3-[tert-butyl(dimethyl)silyl]-5-iodooctan-4-one (PubChem CID 11760361) has the molecular formula C14H29IOSi and a molecular weight of 368.38 g/mol. Its IUPAC name is (3S,5S)-3-[tert-butyl(dimethyl)silyl]-5-iodooctan-4-one.
| Compound Name | (3S,5S)-3-[tert-butyl(dimethyl)silyl]-5-iodooctan-4-one |
|---|---|
| PubChem CID | 11760361 |
| Molecular Formula | C14H29IOSi |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (3S,5S)-3-[tert-butyl(dimethyl)silyl]-5-iodooctan-4-one |
| SMILES | CCC[C@H](I)C(=O)[C@H](CC)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H29IOSi/c1-8-10-11(15)13(16)12(9-2)17(6,7)14(3,4)5/h11-12H,8-10H2,1-7H3/t11-,12-/m0/s1 |
| InChIKey | MHUNWJGNYQUWOX-RYUDHWBXSA-N |
| XLogP | 5.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|