C22H26O5 — CID 11760427
[(2S,4S,5R,6S)-6-methoxy-3-methylidene-4,5-bis(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 11760427) has the molecular formula C22H26O5 and a molecular weight of 370.44 g/mol. Its IUPAC name is [(2S,4S,5R,6S)-6-methoxy-3-methylidene-4,5-bis(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(2S,4S,5R,6S)-6-methoxy-3-methylidene-4,5-bis(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 11760427 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | [(2S,4S,5R,6S)-6-methoxy-3-methylidene-4,5-bis(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | C=C1[C@@H](CO)O[C@H](OC)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H26O5/c1-16-19(13-23)27-22(24-2)21(26-15-18-11-7-4-8-12-18)20(16)25-14-17-9-5-3-6-10-17/h3-12,19-23H,1,13-15H2,2H3/t19-,20+,21-,22+/m1/s1 |
| InChIKey | FTKVIFRJBUMYGP-MBDNFAEBSA-N |
| XLogP | 3.08 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|