About tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane
tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane (PubChem CID 11760439) has the molecular formula C22H30O3Si
and a molecular weight of 370.57 g/mol. Its IUPAC name is tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane |
| PubChem CID | 11760439 |
| Molecular Formula | C22H30O3Si |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane |
| SMILES | COc1cc(/C=C/c2ccc(O[Si](C)(C)C(C)(C)C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C22H30O3Si/c1-22(2,3)26(6,7)25-19-12-10-17(11-13-19)8-9-18-14-20(23-4)16-21(15-18)24-5/h8-16H,1-7H3/b9-8+ |
| InChIKey | PDINJZXKDVUBFQ-CMDGGOBGSA-N |
| XLogP | 6.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane (CID 11760439) is tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane is COc1cc(/C=C/c2ccc(O[Si](C)(C)C(C)(C)C)cc2)cc(OC)c1.
What is the InChIKey of tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane?
The InChIKey is PDINJZXKDVUBFQ-CMDGGOBGSA-N. The full InChI is InChI=1S/C22H30O3Si/c1-22(2,3)26(6,7)25-19-12-10-17(11-13-19)8-9-18-14-20(23-4)16-21(15-18)24-5/h8-16H,1-7H3/b9-8+.
What are the key properties of tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane?
tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane has a molecular weight of 370.57 g/mol, XLogP of 6.26, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane is sourced from PubChem (CID 11760439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).