About 3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide
3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide (PubChem CID 11760447) has the molecular formula C19H15F2N3O3
and a molecular weight of 371.34 g/mol. Its IUPAC name is 3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide.
Molecular Properties
| Compound Name | 3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide |
| PubChem CID | 11760447 |
| Molecular Formula | C19H15F2N3O3 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(Oc2nc(Oc3cccc(O)c3)c(F)c(C)c2F)c1 |
| InChI | InChI=1S/C19H15F2N3O3/c1-10-15(20)18(26-13-6-2-4-11(8-13)17(22)23)24-19(16(10)21)27-14-7-3-5-12(25)9-14/h2-9,25H,1H3,(H3,22,23) |
| InChIKey | GGQDWVMIRHYMNR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide?
The IUPAC name of 3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide (CID 11760447) is 3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide.
What is the SMILES notation for 3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide?
The canonical SMILES for 3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide is [H]/N=C(\N)c1cccc(Oc2nc(Oc3cccc(O)c3)c(F)c(C)c2F)c1.
What is the InChIKey of 3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide?
The InChIKey is GGQDWVMIRHYMNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F2N3O3/c1-10-15(20)18(26-13-6-2-4-11(8-13)17(22)23)24-19(16(10)21)27-14-7-3-5-12(25)9-14/h2-9,25H,1H3,(H3,22,23).
What are the key properties of 3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide?
3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide has a molecular weight of 371.34 g/mol, XLogP of 4.24, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3,5-difluoro-6-(3-hydroxyphenoxy)-4-methyl-2-pyridinyl]oxy]benzenecarboximidamide is sourced from PubChem (CID 11760447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).