C18H28O8 — CID 11760478
ethyl 2-[(1R,2R,6S,7S,9R,10S,15R)-4,4,12,12-tetramethyl-3,5,8,11,13,16-hexaoxatetracyclo[7.7.0.02,6.010,15]hexadecan-7-yl]acetate (PubChem CID 11760478) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is ethyl 2-[(1R,2R,6S,7S,9R,10S,15R)-4,4,12,12-tetramethyl-3,5,8,11,13,16-hexaoxatetracyclo[7.7.0.02,6.010,15]hexadecan-7-yl]acetate.
| Compound Name | ethyl 2-[(1R,2R,6S,7S,9R,10S,15R)-4,4,12,12-tetramethyl-3,5,8,11,13,16-hexaoxatetracyclo[7.7.0.02,6.010,15]hexadecan-7-yl]acetate |
|---|---|
| PubChem CID | 11760478 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | ethyl 2-[(1R,2R,6S,7S,9R,10S,15R)-4,4,12,12-tetramethyl-3,5,8,11,13,16-hexaoxatetracyclo[7.7.0.02,6.010,15]hexadecan-7-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1O[C@@H]2[C@@H](O[C@@H]3COC(C)(C)O[C@H]23)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C18H28O8/c1-6-20-11(19)7-9-12-16(26-18(4,5)25-12)15-14(22-9)13-10(23-15)8-21-17(2,3)24-13/h9-10,12-16H,6-8H2,1-5H3/t9-,10+,12-,13-,14-,15+,16-/m0/s1 |
| InChIKey | YPBPWPSSEAHSRL-WBIJKHACSA-N |
| XLogP | 1.15 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |