About 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate
2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 11760513) has the molecular formula C18H22F3NO4
and a molecular weight of 373.37 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate |
| PubChem CID | 11760513 |
| Molecular Formula | C18H22F3NO4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C(F)(F)F)C[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H22F3NO4/c1-17(2,3)26-16(24)22-10-13(18(19,20)21)9-14(22)15(23)25-11-12-7-5-4-6-8-12/h4-8,13-14H,9-11H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | WFPNAMXQFCFSLL-KBPBESRZSA-N |
| XLogP | 3.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate?
The IUPAC name of 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate (CID 11760513) is 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate is CC(C)(C)OC(=O)N1C[C@@H](C(F)(F)F)C[C@H]1C(=O)OCc1ccccc1.
What is the InChIKey of 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate?
The InChIKey is WFPNAMXQFCFSLL-KBPBESRZSA-N. The full InChI is InChI=1S/C18H22F3NO4/c1-17(2,3)26-16(24)22-10-13(18(19,20)21)9-14(22)15(23)25-11-12-7-5-4-6-8-12/h4-8,13-14H,9-11H2,1-3H3/t13-,14-/m0/s1.
What are the key properties of 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate?
2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate has a molecular weight of 373.37 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-benzyl 1-O-tert-butyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 11760513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).