About N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine
N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine (PubChem CID 11760607) has the molecular formula C26H20NP
and a molecular weight of 377.43 g/mol. Its IUPAC name is N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine.
Molecular Properties
| Compound Name | N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine |
| PubChem CID | 11760607 |
| Molecular Formula | C26H20NP |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine |
| SMILES | C(=C=P(c1ccccc1)(c1ccccc1)c1ccccc1)=Nc1ccccc1 |
| InChI | InChI=1S/C26H20NP/c1-5-13-23(14-6-1)27-21-22-28(24-15-7-2-8-16-24,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20H |
| InChIKey | JTIVZAHHRRRSRM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine?
The IUPAC name of N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine (CID 11760607) is N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine.
What is the SMILES notation for N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine?
The canonical SMILES for N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine is C(=C=P(c1ccccc1)(c1ccccc1)c1ccccc1)=Nc1ccccc1.
What is the InChIKey of N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine?
The InChIKey is JTIVZAHHRRRSRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20NP/c1-5-13-23(14-6-1)27-21-22-28(24-15-7-2-8-16-24,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20H.
What are the key properties of N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine?
N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine has a molecular weight of 377.43 g/mol, XLogP of 4.94, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-2-(triphenyl-λ5-phosphanylidene)ethenimine is sourced from PubChem (CID 11760607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).