C21H15O+ — CID 11760740
methyl(16-pentacyclo[10.7.1.02,7.08,20.013,18]icosa-1(20),2,4,6,8,10,12,14,18-nonaenylidene)oxidanium (PubChem CID 11760740) has the molecular formula C21H15O+ and a molecular weight of 283.35 g/mol. Its IUPAC name is methyl(16-pentacyclo[10.7.1.02,7.08,20.013,18]icosa-1(20),2,4,6,8,10,12,14,18-nonaenylidene)oxidanium.
| Compound Name | methyl(16-pentacyclo[10.7.1.02,7.08,20.013,18]icosa-1(20),2,4,6,8,10,12,14,18-nonaenylidene)oxidanium |
|---|---|
| PubChem CID | 11760740 |
| Molecular Formula | C21H15O+ |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | methyl(16-pentacyclo[10.7.1.02,7.08,20.013,18]icosa-1(20),2,4,6,8,10,12,14,18-nonaenylidene)oxidanium |
| SMILES | C/[O+]=C1\C=Cc2c(cc3c4c(cccc24)-c2ccccc2-3)C1 |
| InChI | InChI=1S/C21H15O/c1-22-14-9-10-15-13(11-14)12-20-17-6-3-2-5-16(17)19-8-4-7-18(15)21(19)20/h2-10,12H,11H2,1H3/q+1 |
| InChIKey | MIFQYIUILHQEHL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|