C25H42OSi — CID 11760857
tert-butyl-dimethyl-[(2E,4Z,6E,8E)-3-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]silane (PubChem CID 11760857) has the molecular formula C25H42OSi and a molecular weight of 386.70 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E,4Z,6E,8E)-3-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2E,4Z,6E,8E)-3-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]silane |
|---|---|
| PubChem CID | 11760857 |
| Molecular Formula | C25H42OSi |
| Molecular Weight | 386.70 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | tert-butyl-dimethyl-[(2E,4Z,6E,8E)-3-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]silane |
| SMILES | CC1=C(/C=C/C=C/C=C\C(C)=C\CO[Si](C)(C)C(C)(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H42OSi/c1-21(18-20-26-27(8,9)24(3,4)5)15-12-10-11-13-17-23-22(2)16-14-19-25(23,6)7/h10-13,15,17-18H,14,16,19-20H2,1-9H3/b11-10+,15-12-,17-13+,21-18+ |
| InChIKey | HDDXDZVVMGMGFK-DXKJKTNBSA-N |
| XLogP | 8.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.70 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|