About difluoro(triphenyl)-λ5-stibane
difluoro(triphenyl)-λ5-stibane (PubChem CID 11760969) has the molecular formula C18H15F2Sb
and a molecular weight of 391.07 g/mol. Its IUPAC name is difluoro(triphenyl)-λ5-stibane.
Molecular Properties
| Compound Name | difluoro(triphenyl)-λ5-stibane |
| PubChem CID | 11760969 |
| Molecular Formula | C18H15F2Sb |
| Molecular Weight | 391.07 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | difluoro(triphenyl)-λ5-stibane |
| SMILES | F[Sb](F)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/3C6H5.2FH.Sb/c3*1-2-4-6-5-3-1;;;/h3*1-5H;2*1H;/q;;;;;+2/p-2 |
| InChIKey | RYEXSDMSNGJYSX-UHFFFAOYSA-L |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.07 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze difluoro(triphenyl)-λ5-stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoro(triphenyl)-λ5-stibane?
The IUPAC name of difluoro(triphenyl)-λ5-stibane (CID 11760969) is difluoro(triphenyl)-λ5-stibane.
What is the SMILES notation for difluoro(triphenyl)-λ5-stibane?
The canonical SMILES for difluoro(triphenyl)-λ5-stibane is F[Sb](F)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of difluoro(triphenyl)-λ5-stibane?
The InChIKey is RYEXSDMSNGJYSX-UHFFFAOYSA-L. The full InChI is InChI=1S/3C6H5.2FH.Sb/c3*1-2-4-6-5-3-1;;;/h3*1-5H;2*1H;/q;;;;;+2/p-2.
What are the key properties of difluoro(triphenyl)-λ5-stibane?
difluoro(triphenyl)-λ5-stibane has a molecular weight of 391.07 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for difluoro(triphenyl)-λ5-stibane is sourced from PubChem (CID 11760969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).