C26H23NO3 — CID 11761126
(E)-1-[3-(4-methoxyphenyl)-5-phenyl-4,5-dihydro-1,2-oxazol-4-yl]-2-methyl-3-phenylprop-2-en-1-one (PubChem CID 11761126) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is (E)-1-[3-(4-methoxyphenyl)-5-phenyl-4,5-dihydro-1,2-oxazol-4-yl]-2-methyl-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[3-(4-methoxyphenyl)-5-phenyl-4,5-dihydro-1,2-oxazol-4-yl]-2-methyl-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 11761126 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (E)-1-[3-(4-methoxyphenyl)-5-phenyl-4,5-dihydro-1,2-oxazol-4-yl]-2-methyl-3-phenylprop-2-en-1-one |
| SMILES | COc1ccc(C2=NOC(c3ccccc3)C2C(=O)/C(C)=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23NO3/c1-18(17-19-9-5-3-6-10-19)25(28)23-24(20-13-15-22(29-2)16-14-20)27-30-26(23)21-11-7-4-8-12-21/h3-17,23,26H,1-2H3/b18-17+ |
| InChIKey | ISYWMEMPFBYBJD-ISLYRVAYSA-N |
| XLogP | 5.46 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|