C21H34O7 — CID 11761146
[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (E)-4-ethyl-2-methylhex-2-enoate (PubChem CID 11761146) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (E)-4-ethyl-2-methylhex-2-enoate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (E)-4-ethyl-2-methylhex-2-enoate |
|---|---|
| PubChem CID | 11761146 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] (E)-4-ethyl-2-methylhex-2-enoate |
| SMILES | CCC(/C=C(\C)C(=O)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1)CC |
| InChI | InChI=1S/C21H34O7/c1-8-13(9-2)10-12(3)18(22)24-16-15(14-11-23-20(4,5)26-14)25-19-17(16)27-21(6,7)28-19/h10,13-17,19H,8-9,11H2,1-7H3/b12-10+/t14-,15-,16+,17-,19-/m1/s1 |
| InChIKey | BVEBMRGWPZWMKI-XQTQRCFESA-N |
| XLogP | 3.31 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|