C18H22O6S2 — CID 11761148
[(3R,4S,5R)-4,5-diacetyloxy-6-benzylsulfanylthian-3-yl] acetate (PubChem CID 11761148) has the molecular formula C18H22O6S2 and a molecular weight of 398.50 g/mol. Its IUPAC name is [(3R,4S,5R)-4,5-diacetyloxy-6-benzylsulfanylthian-3-yl] acetate.
| Compound Name | [(3R,4S,5R)-4,5-diacetyloxy-6-benzylsulfanylthian-3-yl] acetate |
|---|---|
| PubChem CID | 11761148 |
| Molecular Formula | C18H22O6S2 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | [(3R,4S,5R)-4,5-diacetyloxy-6-benzylsulfanylthian-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)CSC(SCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H22O6S2/c1-11(19)22-15-10-26-18(25-9-14-7-5-4-6-8-14)17(24-13(3)21)16(15)23-12(2)20/h4-8,15-18H,9-10H2,1-3H3/t15-,16-,17+,18?/m0/s1 |
| InChIKey | GWJUAQPOIAVDKF-XNHLSEOASA-N |
| XLogP | 2.79 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|