About [(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate
[(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate (PubChem CID 11761189) has the molecular formula C18H28N2O8
and a molecular weight of 400.43 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate.
Molecular Properties
| Compound Name | [(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate |
| PubChem CID | 11761189 |
| Molecular Formula | C18H28N2O8 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H]1OC(OC(C)=O)C[C@@H]1N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C18H28N2O8/c1-11(21)19-5-7-20(8-6-19)15-9-17(27-14(4)24)28-18(15)16(26-13(3)23)10-25-12(2)22/h15-18H,5-10H2,1-4H3/t15-,16+,17?,18-/m0/s1 |
| InChIKey | PBAKKSXVYNVOHT-WFFDWFOESA-N |
| XLogP | -0.31 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate?
The IUPAC name of [(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate (CID 11761189) is [(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate.
What is the SMILES notation for [(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate?
The canonical SMILES for [(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate is CC(=O)OC[C@@H](OC(C)=O)[C@H]1OC(OC(C)=O)C[C@@H]1N1CCN(C(C)=O)CC1.
What is the InChIKey of [(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate?
The InChIKey is PBAKKSXVYNVOHT-WFFDWFOESA-N. The full InChI is InChI=1S/C18H28N2O8/c1-11(21)19-5-7-20(8-6-19)15-9-17(27-14(4)24)28-18(15)16(26-13(3)23)10-25-12(2)22/h15-18H,5-10H2,1-4H3/t15-,16+,17?,18-/m0/s1.
What are the key properties of [(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate?
[(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate has a molecular weight of 400.43 g/mol, XLogP of -0.31, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-acetyloxy-2-[(2S,3S)-5-acetyloxy-3-(4-acetylpiperazin-1-yl)oxolan-2-yl]ethyl] acetate is sourced from PubChem (CID 11761189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).