C17H17Cl2NO4S — CID 11761219
methyl (2S,3R)-3-chloro-3-(2-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 11761219) has the molecular formula C17H17Cl2NO4S and a molecular weight of 402.30 g/mol. Its IUPAC name is methyl (2S,3R)-3-chloro-3-(2-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2S,3R)-3-chloro-3-(2-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 11761219 |
| Molecular Formula | C17H17Cl2NO4S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | methyl (2S,3R)-3-chloro-3-(2-chlorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@H](NS(=O)(=O)c1ccc(C)cc1)[C@H](Cl)c1ccccc1Cl |
| InChI | InChI=1S/C17H17Cl2NO4S/c1-11-7-9-12(10-8-11)25(22,23)20-16(17(21)24-2)15(19)13-5-3-4-6-14(13)18/h3-10,15-16,20H,1-2H3/t15-,16-/m1/s1 |
| InChIKey | REQJEQQMQHLCJQ-HZPDHXFCSA-N |
| XLogP | 3.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|