C15H11IN2O2S — CID 11761387
4-(4-iodophenoxy)-N-methylthieno[2,3-c]pyridine-2-carboxamide (PubChem CID 11761387) has the molecular formula C15H11IN2O2S and a molecular weight of 410.24 g/mol. Its IUPAC name is 4-(4-iodophenoxy)-N-methylthieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | 4-(4-iodophenoxy)-N-methylthieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11761387 |
| Molecular Formula | C15H11IN2O2S |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | 4-(4-iodophenoxy)-N-methylthieno[2,3-c]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc2c(Oc3ccc(I)cc3)cncc2s1 |
| InChI | InChI=1S/C15H11IN2O2S/c1-17-15(19)13-6-11-12(7-18-8-14(11)21-13)20-10-4-2-9(16)3-5-10/h2-8H,1H3,(H,17,19) |
| InChIKey | QHMOZKVAGIEXJR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|