C18H26O11 — CID 11761554
methyl 3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate (PubChem CID 11761554) has the molecular formula C18H26O11 and a molecular weight of 418.40 g/mol. Its IUPAC name is methyl 3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate.
| Compound Name | methyl 3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate |
|---|---|
| PubChem CID | 11761554 |
| Molecular Formula | C18H26O11 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | methyl 3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H26O11/c1-9(19)25-8-14-17(27-11(3)21)18(28-12(4)22)16(26-10(2)20)13(29-14)6-7-15(23)24-5/h13-14,16-18H,6-8H2,1-5H3/t13-,14-,16+,17-,18-/m1/s1 |
| InChIKey | YGONZQILPVUJHN-AGTSVGGPSA-N |
| XLogP | 0.07 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|