C27H27N3O2 — CID 11761693
N-(cyanomethyl)-3-(3,5-dimethylphenyl)-2-[(2,2-diphenylacetyl)amino]propanamide (PubChem CID 11761693) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-(cyanomethyl)-3-(3,5-dimethylphenyl)-2-[(2,2-diphenylacetyl)amino]propanamide.
| Compound Name | N-(cyanomethyl)-3-(3,5-dimethylphenyl)-2-[(2,2-diphenylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 11761693 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-(cyanomethyl)-3-(3,5-dimethylphenyl)-2-[(2,2-diphenylacetyl)amino]propanamide |
| SMILES | Cc1cc(C)cc(CC(NC(=O)C(c2ccccc2)c2ccccc2)C(=O)NCC#N)c1 |
| InChI | InChI=1S/C27H27N3O2/c1-19-15-20(2)17-21(16-19)18-24(26(31)29-14-13-28)30-27(32)25(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-12,15-17,24-25H,14,18H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | UHSPVUASELRRIQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|