C23H46O3Si2 — CID 11761729
[(2S,3R,4R,5R)-2-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxy-5-prop-2-enyloxolan-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11761729) has the molecular formula C23H46O3Si2 and a molecular weight of 426.79 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxy-5-prop-2-enyloxolan-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3R,4R,5R)-2-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxy-5-prop-2-enyloxolan-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11761729 |
| Molecular Formula | C23H46O3Si2 |
| Molecular Weight | 426.79 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | [(2S,3R,4R,5R)-2-but-3-enyl-4-[tert-butyl(dimethyl)silyl]oxy-5-prop-2-enyloxolan-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CCC[C@@H]1O[C@H](CC=C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O3Si2/c1-13-15-17-19-21(26-28(11,12)23(6,7)8)20(18(24-19)16-14-2)25-27(9,10)22(3,4)5/h13-14,18-21H,1-2,15-17H2,3-12H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | WQSUCUHGHCWBIQ-PLACYPQZSA-N |
| XLogP | 7.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.79 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|