C25H30O3SSi — CID 11761950
(6Z,11Z)-10-[tert-butyl(dimethyl)silyl]oxy-10-methyl-11-phenylsulfanyl-1-oxacyclotrideca-6,11-dien-4,8-diyn-2-one (PubChem CID 11761950) has the molecular formula C25H30O3SSi and a molecular weight of 438.67 g/mol. Its IUPAC name is (6Z,11Z)-10-[tert-butyl(dimethyl)silyl]oxy-10-methyl-11-phenylsulfanyl-1-oxacyclotrideca-6,11-dien-4,8-diyn-2-one.
| Compound Name | (6Z,11Z)-10-[tert-butyl(dimethyl)silyl]oxy-10-methyl-11-phenylsulfanyl-1-oxacyclotrideca-6,11-dien-4,8-diyn-2-one |
|---|---|
| PubChem CID | 11761950 |
| Molecular Formula | C25H30O3SSi |
| Molecular Weight | 438.67 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (6Z,11Z)-10-[tert-butyl(dimethyl)silyl]oxy-10-methyl-11-phenylsulfanyl-1-oxacyclotrideca-6,11-dien-4,8-diyn-2-one |
| SMILES | CC1(O[Si](C)(C)C(C)(C)C)C#C/C=C\C#CCC(=O)OC/C=C/1Sc1ccccc1 |
| InChI | InChI=1S/C25H30O3SSi/c1-24(2,3)30(5,6)28-25(4)19-14-9-7-8-13-17-23(26)27-20-18-22(25)29-21-15-11-10-12-16-21/h7,9-12,15-16,18H,17,20H2,1-6H3/b9-7-,22-18- |
| InChIKey | ILEPSPASDDBCQR-ZNWHPYOJSA-N |
| XLogP | 5.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.67 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|