C26H25N5O2 — CID 11761967
(3-carbamimidoylphenyl)methyl 1-[(3-carbamimidoylphenyl)methyl]-4-methylindole-2-carboxylate (PubChem CID 11761967) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is (3-carbamimidoylphenyl)methyl 1-[(3-carbamimidoylphenyl)methyl]-4-methylindole-2-carboxylate.
| Compound Name | (3-carbamimidoylphenyl)methyl 1-[(3-carbamimidoylphenyl)methyl]-4-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 11761967 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (3-carbamimidoylphenyl)methyl 1-[(3-carbamimidoylphenyl)methyl]-4-methylindole-2-carboxylate |
| SMILES | [H]/N=C(\N)c1cccc(COC(=O)c2cc3c(C)cccc3n2Cc2cccc(/C(N)=N/[H])c2)c1 |
| InChI | InChI=1S/C26H25N5O2/c1-16-5-2-10-22-21(16)13-23(31(22)14-17-6-3-8-19(11-17)24(27)28)26(32)33-15-18-7-4-9-20(12-18)25(29)30/h2-13H,14-15H2,1H3,(H3,27,28)(H3,29,30) |
| InChIKey | BKMPNKBWORCDEJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 130.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|