C25H28N6O2 — CID 11762052
9-cyclobutyl-2-N,6-N-bis[(4-methoxyphenyl)methyl]purine-2,6-diamine (PubChem CID 11762052) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 9-cyclobutyl-2-N,6-N-bis[(4-methoxyphenyl)methyl]purine-2,6-diamine.
| Compound Name | 9-cyclobutyl-2-N,6-N-bis[(4-methoxyphenyl)methyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 11762052 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 9-cyclobutyl-2-N,6-N-bis[(4-methoxyphenyl)methyl]purine-2,6-diamine |
| SMILES | COc1ccc(CNc2nc(NCc3ccc(OC)cc3)c3ncn(C4CCC4)c3n2)cc1 |
| InChI | InChI=1S/C25H28N6O2/c1-32-20-10-6-17(7-11-20)14-26-23-22-24(31(16-28-22)19-4-3-5-19)30-25(29-23)27-15-18-8-12-21(33-2)13-9-18/h6-13,16,19H,3-5,14-15H2,1-2H3,(H2,26,27,29,30) |
| InChIKey | MDEOMAUPXVVVKD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |