About dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate
dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate (PubChem CID 11762263) has the molecular formula C22H38N2O8
and a molecular weight of 458.55 g/mol. Its IUPAC name is dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate.
Molecular Properties
| Compound Name | dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate |
| PubChem CID | 11762263 |
| Molecular Formula | C22H38N2O8 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate |
| SMILES | COC(=O)C(CC/C=C/CCC(NC(=O)OC(C)(C)C)C(=O)OC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H38N2O8/c1-21(2,3)31-19(27)23-15(17(25)29-7)13-11-9-10-12-14-16(18(26)30-8)24-20(28)32-22(4,5)6/h9-10,15-16H,11-14H2,1-8H3,(H,23,27)(H,24,28)/b10-9+ |
| InChIKey | CKVNGCMZPZHERJ-MDZDMXLPSA-N |
| XLogP | 3.24 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate?
The IUPAC name of dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate (CID 11762263) is dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate.
What is the SMILES notation for dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate?
The canonical SMILES for dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate is COC(=O)C(CC/C=C/CCC(NC(=O)OC(C)(C)C)C(=O)OC)NC(=O)OC(C)(C)C.
What is the InChIKey of dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate?
The InChIKey is CKVNGCMZPZHERJ-MDZDMXLPSA-N. The full InChI is InChI=1S/C22H38N2O8/c1-21(2,3)31-19(27)23-15(17(25)29-7)13-11-9-10-12-14-16(18(26)30-8)24-20(28)32-22(4,5)6/h9-10,15-16H,11-14H2,1-8H3,(H,23,27)(H,24,28)/b10-9+.
What are the key properties of dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate?
dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate has a molecular weight of 458.55 g/mol, XLogP of 3.24, 10 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (E)-2,9-bis[(2-methylpropan-2-yl)oxycarbonylamino]dec-5-enedioate is sourced from PubChem (CID 11762263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).