C14H9Br2N3O3S — CID 11762270
6,8-dibromo-3-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]chromen-2-one (PubChem CID 11762270) has the molecular formula C14H9Br2N3O3S and a molecular weight of 459.12 g/mol. Its IUPAC name is 6,8-dibromo-3-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]chromen-2-one.
| Compound Name | 6,8-dibromo-3-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]chromen-2-one |
|---|---|
| PubChem CID | 11762270 |
| Molecular Formula | C14H9Br2N3O3S |
| Molecular Weight | 459.12 g/mol |
| Exact Mass | 456.87 |
| IUPAC Name | 6,8-dibromo-3-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]chromen-2-one |
| SMILES | Cc1nc(SCC(=O)c2cc3cc(Br)cc(Br)c3oc2=O)n[nH]1 |
| InChI | InChI=1S/C14H9Br2N3O3S/c1-6-17-14(19-18-6)23-5-11(20)9-3-7-2-8(15)4-10(16)12(7)22-13(9)21/h2-4H,5H2,1H3,(H,17,18,19) |
| InChIKey | APUXFXPZNCASPU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.12 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|