C27H48O5Si — CID 11762580
methyl 2-[(1R,4R,8S,9R,10S,11R,12S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-cyclopentyl-11-hydroxy-10-methyl-2-oxatricyclo[6.3.1.04,12]dodecan-9-yl]acetate (PubChem CID 11762580) has the molecular formula C27H48O5Si and a molecular weight of 480.76 g/mol. Its IUPAC name is methyl 2-[(1R,4R,8S,9R,10S,11R,12S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-cyclopentyl-11-hydroxy-10-methyl-2-oxatricyclo[6.3.1.04,12]dodecan-9-yl]acetate.
| Compound Name | methyl 2-[(1R,4R,8S,9R,10S,11R,12S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-cyclopentyl-11-hydroxy-10-methyl-2-oxatricyclo[6.3.1.04,12]dodecan-9-yl]acetate |
|---|---|
| PubChem CID | 11762580 |
| Molecular Formula | C27H48O5Si |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | methyl 2-[(1R,4R,8S,9R,10S,11R,12S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-cyclopentyl-11-hydroxy-10-methyl-2-oxatricyclo[6.3.1.04,12]dodecan-9-yl]acetate |
| SMILES | COC(=O)C[C@@H]1[C@@]2(CO[Si](C)(C)C(C)(C)C)CCC[C@H]3CO[C@H]([C@@H]32)[C@H](O)[C@@]1(C)C1CCCC1 |
| InChI | InChI=1S/C27H48O5Si/c1-25(2,3)33(6,7)32-17-27-14-10-11-18-16-31-23(22(18)27)24(29)26(4,19-12-8-9-13-19)20(27)15-21(28)30-5/h18-20,22-24,29H,8-17H2,1-7H3/t18-,20-,22+,23+,24-,26-,27-/m0/s1 |
| InChIKey | JHTIMHKTRGZKKL-XSOZJGHNSA-N |
| XLogP | 5.56 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|