C22H23F3N2O6S — CID 11762829
methyl (1S,4aS,8aR)-1-methyl-6-oxo-7-[2-[1-(trifluoromethylsulfonyl)indol-3-yl]ethyl]-4a,5,8,8a-tetrahydro-1H-pyrano[3,4-c]pyridine-4-carboxylate (PubChem CID 11762829) has the molecular formula C22H23F3N2O6S and a molecular weight of 500.50 g/mol. Its IUPAC name is methyl (1S,4aS,8aR)-1-methyl-6-oxo-7-[2-[1-(trifluoromethylsulfonyl)indol-3-yl]ethyl]-4a,5,8,8a-tetrahydro-1H-pyrano[3,4-c]pyridine-4-carboxylate.
| Compound Name | methyl (1S,4aS,8aR)-1-methyl-6-oxo-7-[2-[1-(trifluoromethylsulfonyl)indol-3-yl]ethyl]-4a,5,8,8a-tetrahydro-1H-pyrano[3,4-c]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 11762829 |
| Molecular Formula | C22H23F3N2O6S |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | methyl (1S,4aS,8aR)-1-methyl-6-oxo-7-[2-[1-(trifluoromethylsulfonyl)indol-3-yl]ethyl]-4a,5,8,8a-tetrahydro-1H-pyrano[3,4-c]pyridine-4-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](C)[C@H]2CN(CCc3cn(S(=O)(=O)C(F)(F)F)c4ccccc34)C(=O)C[C@H]12 |
| InChI | InChI=1S/C22H23F3N2O6S/c1-13-17-11-26(20(28)9-16(17)18(12-33-13)21(29)32-2)8-7-14-10-27(34(30,31)22(23,24)25)19-6-4-3-5-15(14)19/h3-6,10,12-13,16-17H,7-9,11H2,1-2H3/t13-,16-,17+/m0/s1 |
| InChIKey | HYAWRNMSCORBHC-RRQGHBQHSA-N |
| XLogP | 2.82 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |