C29H52O5Si — CID 11762936
[(2E,4E,7S)-8-[(2S,6R)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]-4-methyl-7-tri(propan-2-yl)silyloxyocta-2,4-dienyl] 2,2-dimethylpropanoate (PubChem CID 11762936) has the molecular formula C29H52O5Si and a molecular weight of 508.82 g/mol. Its IUPAC name is [(2E,4E,7S)-8-[(2S,6R)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]-4-methyl-7-tri(propan-2-yl)silyloxyocta-2,4-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(2E,4E,7S)-8-[(2S,6R)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]-4-methyl-7-tri(propan-2-yl)silyloxyocta-2,4-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11762936 |
| Molecular Formula | C29H52O5Si |
| Molecular Weight | 508.82 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | [(2E,4E,7S)-8-[(2S,6R)-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]-4-methyl-7-tri(propan-2-yl)silyloxyocta-2,4-dienyl] 2,2-dimethylpropanoate |
| SMILES | CC(/C=C/COC(=O)C(C)(C)C)=C\C[C@@H](C[C@@H]1C=CC[C@@H](CO)O1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H52O5Si/c1-21(2)35(22(3)4,23(5)6)34-26(19-25-14-11-15-27(20-30)33-25)17-16-24(7)13-12-18-32-28(31)29(8,9)10/h11-14,16,21-23,25-27,30H,15,17-20H2,1-10H3/b13-12+,24-16+/t25-,26-,27-/m0/s1 |
| InChIKey | GOGZHHQYPBOMNL-CXDWNXILSA-N |
| XLogP | 7.13 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.82 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|