C30H23N7O2 — CID 11762982
N-[4-(furan-2-yl)-11-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-naphthalen-1-ylacetamide (PubChem CID 11762982) has the molecular formula C30H23N7O2 and a molecular weight of 513.56 g/mol. Its IUPAC name is N-[4-(furan-2-yl)-11-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[4-(furan-2-yl)-11-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 11762982 |
| Molecular Formula | C30H23N7O2 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | N-[4-(furan-2-yl)-11-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-2-naphthalen-1-ylacetamide |
| SMILES | O=C(Cc1cccc2ccccc12)Nc1nc2nn(CCc3ccccc3)cc2c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C30H23N7O2/c38-26(18-22-12-6-11-21-10-4-5-13-23(21)22)31-30-33-27-24(19-36(34-27)16-15-20-8-2-1-3-9-20)29-32-28(35-37(29)30)25-14-7-17-39-25/h1-14,17,19H,15-16,18H2,(H,31,33,34,38) |
| InChIKey | ZWOVBVVGJSVBEE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |