C28H28ClN3O5 — CID 11763076
[6-(dimethylamino)-9-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]-9,9a-dihydroxanthen-3-ylidene]-dimethylazanium chloride (PubChem CID 11763076) has the molecular formula C28H28ClN3O5 and a molecular weight of 522.00 g/mol. Its IUPAC name is [6-(dimethylamino)-9-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]-9,9a-dihydroxanthen-3-ylidene]-dimethylazanium chloride.
| Compound Name | [6-(dimethylamino)-9-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]-9,9a-dihydroxanthen-3-ylidene]-dimethylazanium chloride |
|---|---|
| PubChem CID | 11763076 |
| Molecular Formula | C28H28ClN3O5 |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | [6-(dimethylamino)-9-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]-9,9a-dihydroxanthen-3-ylidene]-dimethylazanium chloride |
| SMILES | CN(C)c1ccc2c(c1)OC1=CC(=[N+](C)C)C=CC1C2c1ccccc1C(=O)ON1C(=O)CCC1=O.[Cl-] |
| InChI | InChI=1S/C28H28N3O5.ClH/c1-29(2)17-9-11-21-23(15-17)35-24-16-18(30(3)4)10-12-22(24)27(21)19-7-5-6-8-20(19)28(34)36-31-25(32)13-14-26(31)33;/h5-12,15-16,21,27H,13-14H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | LYYFGMKBCDINHO-UHFFFAOYSA-M |
| XLogP | 0.28 |
| TPSA | 79.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|