C18H33F3O8SSi2 — CID 11763087
[(6aR,9S,9aS)-8-oxo-2,2,4,4-tetra(propan-2-yl)-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] trifluoromethanesulfonate (PubChem CID 11763087) has the molecular formula C18H33F3O8SSi2 and a molecular weight of 522.69 g/mol. Its IUPAC name is [(6aR,9S,9aS)-8-oxo-2,2,4,4-tetra(propan-2-yl)-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] trifluoromethanesulfonate.
| Compound Name | [(6aR,9S,9aS)-8-oxo-2,2,4,4-tetra(propan-2-yl)-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11763087 |
| Molecular Formula | C18H33F3O8SSi2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | [(6aR,9S,9aS)-8-oxo-2,2,4,4-tetra(propan-2-yl)-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] trifluoromethanesulfonate |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2OC(=O)[C@@H](OS(=O)(=O)C(F)(F)F)[C@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C18H33F3O8SSi2/c1-10(2)31(11(3)4)25-9-14-15(28-32(29-31,12(5)6)13(7)8)16(17(22)26-14)27-30(23,24)18(19,20)21/h10-16H,9H2,1-8H3/t14-,15+,16+/m1/s1 |
| InChIKey | APSFJONTDVWGDM-PMPSAXMXSA-N |
| XLogP | 4.10 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|