C27H52N2O4Si2 — CID 11763122
tert-butyl N-[4-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]phenyl]carbamate (PubChem CID 11763122) has the molecular formula C27H52N2O4Si2 and a molecular weight of 524.90 g/mol. Its IUPAC name is tert-butyl N-[4-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 11763122 |
| Molecular Formula | C27H52N2O4Si2 |
| Molecular Weight | 524.90 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | tert-butyl N-[4-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(N(CCO[Si](C)(C)C(C)(C)C)CCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H52N2O4Si2/c1-25(2,3)33-24(30)28-22-14-16-23(17-15-22)29(18-20-31-34(10,11)26(4,5)6)19-21-32-35(12,13)27(7,8)9/h14-17H,18-21H2,1-13H3,(H,28,30) |
| InChIKey | GOPHAURXVMDFQL-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.90 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|