About 4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide
4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide (PubChem CID 1176317) has the molecular formula C20H21N3O4S2
and a molecular weight of 431.54 g/mol. Its IUPAC name is 4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide.
Molecular Properties
| Compound Name | 4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide |
| PubChem CID | 1176317 |
| Molecular Formula | C20H21N3O4S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)N(CCc2ccccc2)Cc2ccccn2)cc1 |
| InChI | InChI=1S/C20H21N3O4S2/c21-28(24,25)19-9-11-20(12-10-19)29(26,27)23(16-18-8-4-5-14-22-18)15-13-17-6-2-1-3-7-17/h1-12,14H,13,15-16H2,(H2,21,24,25) |
| InChIKey | AMMSGGUWWDJKHL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide?
The IUPAC name of 4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide (CID 1176317) is 4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide.
What is the SMILES notation for 4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide?
The canonical SMILES for 4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide is NS(=O)(=O)c1ccc(S(=O)(=O)N(CCc2ccccc2)Cc2ccccn2)cc1.
What is the InChIKey of 4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide?
The InChIKey is AMMSGGUWWDJKHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O4S2/c21-28(24,25)19-9-11-20(12-10-19)29(26,27)23(16-18-8-4-5-14-22-18)15-13-17-6-2-1-3-7-17/h1-12,14H,13,15-16H2,(H2,21,24,25).
What are the key properties of 4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide?
4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide has a molecular weight of 431.54 g/mol, XLogP of 2.16, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(2-phenylethyl)-4-N-(pyridin-2-ylmethyl)benzene-1,4-disulfonamide is sourced from PubChem (CID 1176317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).