C30H31NO6S — CID 11763197
2-[(2S,3R,4R,5S,6R)-2-ethylsulfanyl-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione (PubChem CID 11763197) has the molecular formula C30H31NO6S and a molecular weight of 533.65 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5S,6R)-2-ethylsulfanyl-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3R,4R,5S,6R)-2-ethylsulfanyl-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11763197 |
| Molecular Formula | C30H31NO6S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 2-[(2S,3R,4R,5S,6R)-2-ethylsulfanyl-5-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]isoindole-1,3-dione |
| SMILES | CCS[C@@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](OCc2ccccc2)[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H31NO6S/c1-2-38-30-25(31-28(33)22-15-9-10-16-23(22)29(31)34)27(36-18-21-13-7-4-8-14-21)26(32)24(37-30)19-35-17-20-11-5-3-6-12-20/h3-16,24-27,30,32H,2,17-19H2,1H3/t24-,25-,26-,27-,30+/m1/s1 |
| InChIKey | ZJRWIBCTRDXSCL-YFQBHRANSA-N |
| XLogP | 4.29 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|