C24H24INO4S — CID 11763347
[5-(diethylamino)-2-[2-(2-iodophenyl)acetyl]phenyl] benzenesulfonate (PubChem CID 11763347) has the molecular formula C24H24INO4S and a molecular weight of 549.43 g/mol. Its IUPAC name is [5-(diethylamino)-2-[2-(2-iodophenyl)acetyl]phenyl] benzenesulfonate.
| Compound Name | [5-(diethylamino)-2-[2-(2-iodophenyl)acetyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 11763347 |
| Molecular Formula | C24H24INO4S |
| Molecular Weight | 549.43 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | [5-(diethylamino)-2-[2-(2-iodophenyl)acetyl]phenyl] benzenesulfonate |
| SMILES | CCN(CC)c1ccc(C(=O)Cc2ccccc2I)c(OS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H24INO4S/c1-3-26(4-2)19-14-15-21(23(27)16-18-10-8-9-13-22(18)25)24(17-19)30-31(28,29)20-11-6-5-7-12-20/h5-15,17H,3-4,16H2,1-2H3 |
| InChIKey | NIHCYQGAJDTRLF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|