C36H54O4 — CID 11763359
(1R,5R,7S,8R)-4-methoxy-8-methyl-3,5,7-tris(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 11763359) has the molecular formula C36H54O4 and a molecular weight of 550.82 g/mol. Its IUPAC name is (1R,5R,7S,8R)-4-methoxy-8-methyl-3,5,7-tris(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (1R,5R,7S,8R)-4-methoxy-8-methyl-3,5,7-tris(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 11763359 |
| Molecular Formula | C36H54O4 |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.40 |
| IUPAC Name | (1R,5R,7S,8R)-4-methoxy-8-methyl-3,5,7-tris(3-methylbut-2-enyl)-8-(4-methylpent-3-enyl)-1-(2-methylpropanoyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | COC1=C(CC=C(C)C)C(=O)[C@@]2(C(=O)C(C)C)C(=O)[C@]1(CC=C(C)C)C[C@H](CC=C(C)C)[C@@]2(C)CCC=C(C)C |
| InChI | InChI=1S/C36H54O4/c1-23(2)14-13-20-34(11)28(17-15-24(3)4)22-35(21-19-26(7)8)32(40-12)29(18-16-25(5)6)31(38)36(34,33(35)39)30(37)27(9)10/h14-16,19,27-28H,13,17-18,20-22H2,1-12H3/t28-,34+,35+,36-/m0/s1 |
| InChIKey | IMKQQDIZLPKHBK-OQXPXOCRSA-N |
| XLogP | 9.08 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|