C30H66O6Si4 — CID 11763588
(3R,4S,5R,6R)-3,4,5-tris(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-2-one (PubChem CID 11763588) has the molecular formula C30H66O6Si4 and a molecular weight of 635.20 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3,4,5-tris(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-2-one.
| Compound Name | (3R,4S,5R,6R)-3,4,5-tris(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 11763588 |
| Molecular Formula | C30H66O6Si4 |
| Molecular Weight | 635.20 g/mol |
| Exact Mass | 634.39 |
| IUPAC Name | (3R,4S,5R,6R)-3,4,5-tris(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-2-one |
| SMILES | CC[Si](CC)(CC)OC[C@H]1OC(=O)[C@H](O[Si](CC)(CC)CC)[C@@H](O[Si](CC)(CC)CC)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C30H66O6Si4/c1-13-37(14-2,15-3)32-25-26-27(34-38(16-4,17-5)18-6)28(35-39(19-7,20-8)21-9)29(30(31)33-26)36-40(22-10,23-11)24-12/h26-29H,13-25H2,1-12H3/t26-,27-,28+,29-/m1/s1 |
| InChIKey | DFWVIFANXWWLOK-OVHUPFAXSA-N |
| XLogP | 9.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.20 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|