C36H60O5Si3 — CID 11763729
(2R,3S,4S,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxane-2-carbaldehyde (PubChem CID 11763729) has the molecular formula C36H60O5Si3 and a molecular weight of 657.13 g/mol. Its IUPAC name is (2R,3S,4S,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxane-2-carbaldehyde.
| Compound Name | (2R,3S,4S,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxane-2-carbaldehyde |
|---|---|
| PubChem CID | 11763729 |
| Molecular Formula | C36H60O5Si3 |
| Molecular Weight | 657.13 g/mol |
| Exact Mass | 656.37 |
| IUPAC Name | (2R,3S,4S,6R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxane-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](C=O)O[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H60O5Si3/c1-34(2,3)42(10,11)40-31-26-28(39-32(27-37)33(31)41-43(12,13)35(4,5)6)24-25-38-44(36(7,8)9,29-20-16-14-17-21-29)30-22-18-15-19-23-30/h14-23,27-28,31-33H,24-26H2,1-13H3/t28-,31+,32+,33-/m1/s1 |
| InChIKey | PSMHBVBRYHNASX-KYXYXWHUSA-N |
| XLogP | 8.09 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.13 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|