C32H36ClF3N6O4 — CID 11763747
5-chloro-7-(4-methylpiperidin-1-yl)-6-(2,4,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine;methyl (2R)-2-(N-(2-methoxyacetyl)-2,6-dimethylanilino)propanoate (PubChem CID 11763747) has the molecular formula C32H36ClF3N6O4 and a molecular weight of 661.13 g/mol. Its IUPAC name is 5-chloro-7-(4-methylpiperidin-1-yl)-6-(2,4,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine;methyl (2R)-2-(N-(2-methoxyacetyl)-2,6-dimethylanilino)propanoate.
| Compound Name | 5-chloro-7-(4-methylpiperidin-1-yl)-6-(2,4,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine;methyl (2R)-2-(N-(2-methoxyacetyl)-2,6-dimethylanilino)propanoate |
|---|---|
| PubChem CID | 11763747 |
| Molecular Formula | C32H36ClF3N6O4 |
| Molecular Weight | 661.13 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | 5-chloro-7-(4-methylpiperidin-1-yl)-6-(2,4,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine;methyl (2R)-2-(N-(2-methoxyacetyl)-2,6-dimethylanilino)propanoate |
| SMILES | CC1CCN(c2c(-c3c(F)cc(F)cc3F)c(Cl)nc3ncnn23)CC1.COCC(=O)N(c1c(C)cccc1C)[C@H](C)C(=O)OC |
| InChI | InChI=1S/C17H15ClF3N5.C15H21NO4/c1-9-2-4-25(5-3-9)16-14(13-11(20)6-10(19)7-12(13)21)15(18)24-17-22-8-23-26(16)17;1-10-7-6-8-11(2)14(10)16(13(17)9-19-4)12(3)15(18)20-5/h6-9H,2-5H2,1H3;6-8,12H,9H2,1-5H3/t;12-/m.1/s1 |
| InChIKey | HPPLQVGJKHAYCR-MBBUEALLSA-N |
| XLogP | 5.94 |
| TPSA | 102.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.13 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |