C43H57N3O5 — CID 11763909
benzyl-[2-(benzylamino)ethyl]azanium;(2S)-2-ethoxy-3-[4-[2-[hexyl(2-phenylethyl)amino]-2-oxoethoxy]phenyl]propanoate (PubChem CID 11763909) has the molecular formula C43H57N3O5 and a molecular weight of 695.95 g/mol. Its IUPAC name is benzyl-[2-(benzylamino)ethyl]azanium;(2S)-2-ethoxy-3-[4-[2-[hexyl(2-phenylethyl)amino]-2-oxoethoxy]phenyl]propanoate.
| Compound Name | benzyl-[2-(benzylamino)ethyl]azanium;(2S)-2-ethoxy-3-[4-[2-[hexyl(2-phenylethyl)amino]-2-oxoethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 11763909 |
| Molecular Formula | C43H57N3O5 |
| Molecular Weight | 695.95 g/mol |
| Exact Mass | 695.43 |
| IUPAC Name | benzyl-[2-(benzylamino)ethyl]azanium;(2S)-2-ethoxy-3-[4-[2-[hexyl(2-phenylethyl)amino]-2-oxoethoxy]phenyl]propanoate |
| SMILES | CCCCCCN(CCc1ccccc1)C(=O)COc1ccc(C[C@H](OCC)C(=O)[O-])cc1.c1ccc(CNCC[NH2+]Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H37NO5.C16H20N2/c1-3-5-6-10-18-28(19-17-22-11-8-7-9-12-22)26(29)21-33-24-15-13-23(14-16-24)20-25(27(30)31)32-4-2;1-3-7-15(8-4-1)13-17-11-12-18-14-16-9-5-2-6-10-16/h7-9,11-16,25H,3-6,10,17-21H2,1-2H3,(H,30,31);1-10,17-18H,11-14H2/t25-;/m0./s1 |
| InChIKey | NNMVALNNCULELT-UQIIZPHYSA-N |
| XLogP | 4.95 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.95 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|