C38H20N2O12 — CID 11763910
2-[[4-[[2-carboxy-5-(1,3-dioxo-2-benzofuran-5-yl)benzoyl]amino]phenyl]carbamoyl]-4-(1,3-dioxo-2-benzofuran-5-yl)benzoic acid (PubChem CID 11763910) has the molecular formula C38H20N2O12 and a molecular weight of 696.58 g/mol. Its IUPAC name is 2-[[4-[[2-carboxy-5-(1,3-dioxo-2-benzofuran-5-yl)benzoyl]amino]phenyl]carbamoyl]-4-(1,3-dioxo-2-benzofuran-5-yl)benzoic acid.
| Compound Name | 2-[[4-[[2-carboxy-5-(1,3-dioxo-2-benzofuran-5-yl)benzoyl]amino]phenyl]carbamoyl]-4-(1,3-dioxo-2-benzofuran-5-yl)benzoic acid |
|---|---|
| PubChem CID | 11763910 |
| Molecular Formula | C38H20N2O12 |
| Molecular Weight | 696.58 g/mol |
| Exact Mass | 696.10 |
| IUPAC Name | 2-[[4-[[2-carboxy-5-(1,3-dioxo-2-benzofuran-5-yl)benzoyl]amino]phenyl]carbamoyl]-4-(1,3-dioxo-2-benzofuran-5-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc3c(c2)C(=O)OC3=O)cc1C(=O)Nc1ccc(NC(=O)c2cc(-c3ccc4c(c3)C(=O)OC4=O)ccc2C(=O)O)cc1 |
| InChI | InChI=1S/C38H20N2O12/c41-31(27-13-17(1-9-23(27)33(43)44)19-3-11-25-29(15-19)37(49)51-35(25)47)39-21-5-7-22(8-6-21)40-32(42)28-14-18(2-10-24(28)34(45)46)20-4-12-26-30(16-20)38(50)52-36(26)48/h1-16H,(H,39,41)(H,40,42)(H,43,44)(H,45,46) |
| InChIKey | PZHHDOKMDPWRPP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 219.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.58 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|