C30H52BCl3O9Si — CID 11763938
(E,3S,6R,7S,8S)-4,4,6,8-tetramethyl-5-oxo-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(2,2,2-trichloroethoxycarbonyloxy)-3-triethylsilyloxyundec-10-enoic acid (PubChem CID 11763938) has the molecular formula C30H52BCl3O9Si and a molecular weight of 701.99 g/mol. Its IUPAC name is (E,3S,6R,7S,8S)-4,4,6,8-tetramethyl-5-oxo-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(2,2,2-trichloroethoxycarbonyloxy)-3-triethylsilyloxyundec-10-enoic acid.
| Compound Name | (E,3S,6R,7S,8S)-4,4,6,8-tetramethyl-5-oxo-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(2,2,2-trichloroethoxycarbonyloxy)-3-triethylsilyloxyundec-10-enoic acid |
|---|---|
| PubChem CID | 11763938 |
| Molecular Formula | C30H52BCl3O9Si |
| Molecular Weight | 701.99 g/mol |
| Exact Mass | 700.25 |
| IUPAC Name | (E,3S,6R,7S,8S)-4,4,6,8-tetramethyl-5-oxo-11-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(2,2,2-trichloroethoxycarbonyloxy)-3-triethylsilyloxyundec-10-enoic acid |
| SMILES | CC[Si](CC)(CC)O[C@@H](CC(=O)O)C(C)(C)C(=O)[C@H](C)[C@@H](OC(=O)OCC(Cl)(Cl)Cl)[C@@H](C)C/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C30H52BCl3O9Si/c1-12-44(13-2,14-3)41-22(18-23(35)36)27(6,7)25(37)21(5)24(40-26(38)39-19-30(32,33)34)20(4)16-15-17-31-42-28(8,9)29(10,11)43-31/h15,17,20-22,24H,12-14,16,18-19H2,1-11H3,(H,35,36)/b17-15+/t20-,21+,22-,24-/m0/s1 |
| InChIKey | KYVQUWFDBXMERG-YOSNDMBNSA-N |
| XLogP | 8.19 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.99 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|