C23H22F2N2O4S2 — CID 1176403
1-N-cyclopropyl-4-N,4-N-bis[(4-fluorophenyl)methyl]benzene-1,4-disulfonamide (PubChem CID 1176403) has the molecular formula C23H22F2N2O4S2 and a molecular weight of 492.57 g/mol. Its IUPAC name is 1-N-cyclopropyl-4-N,4-N-bis[(4-fluorophenyl)methyl]benzene-1,4-disulfonamide.
| Compound Name | 1-N-cyclopropyl-4-N,4-N-bis[(4-fluorophenyl)methyl]benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 1176403 |
| Molecular Formula | C23H22F2N2O4S2 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 1-N-cyclopropyl-4-N,4-N-bis[(4-fluorophenyl)methyl]benzene-1,4-disulfonamide |
| SMILES | O=S(=O)(NC1CC1)c1ccc(S(=O)(=O)N(Cc2ccc(F)cc2)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H22F2N2O4S2/c24-19-5-1-17(2-6-19)15-27(16-18-3-7-20(25)8-4-18)33(30,31)23-13-11-22(12-14-23)32(28,29)26-21-9-10-21/h1-8,11-14,21,26H,9-10,15-16H2 |
| InChIKey | KYDHREAGGRHNHW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |