C40H42O12S2 — CID 11765754
[2-[[2-(2,4-dihydroxy-3,5,6-trimethylbenzoyl)oxy-4-hydroxy-3,5,6-trimethylbenzoyl]disulfanyl]carbonyl-5-hydroxy-3,4,6-trimethylphenyl] 2,4-dihydroxy-3,5,6-trimethylbenzoate (PubChem CID 11765754) has the molecular formula C40H42O12S2 and a molecular weight of 778.90 g/mol. Its IUPAC name is [2-[[2-(2,4-dihydroxy-3,5,6-trimethylbenzoyl)oxy-4-hydroxy-3,5,6-trimethylbenzoyl]disulfanyl]carbonyl-5-hydroxy-3,4,6-trimethylphenyl] 2,4-dihydroxy-3,5,6-trimethylbenzoate.
| Compound Name | [2-[[2-(2,4-dihydroxy-3,5,6-trimethylbenzoyl)oxy-4-hydroxy-3,5,6-trimethylbenzoyl]disulfanyl]carbonyl-5-hydroxy-3,4,6-trimethylphenyl] 2,4-dihydroxy-3,5,6-trimethylbenzoate |
|---|---|
| PubChem CID | 11765754 |
| Molecular Formula | C40H42O12S2 |
| Molecular Weight | 778.90 g/mol |
| Exact Mass | 778.21 |
| IUPAC Name | [2-[[2-(2,4-dihydroxy-3,5,6-trimethylbenzoyl)oxy-4-hydroxy-3,5,6-trimethylbenzoyl]disulfanyl]carbonyl-5-hydroxy-3,4,6-trimethylphenyl] 2,4-dihydroxy-3,5,6-trimethylbenzoate |
| SMILES | Cc1c(C)c(C(=O)Oc2c(C)c(O)c(C)c(C)c2C(=O)SSC(=O)c2c(C)c(C)c(O)c(C)c2OC(=O)c2c(C)c(C)c(O)c(C)c2O)c(O)c(C)c1O |
| InChI | InChI=1S/C40H42O12S2/c1-13-17(5)29(41)21(9)33(45)25(13)37(47)51-35-23(11)31(43)19(7)15(3)27(35)39(49)53-54-40(50)28-16(4)20(8)32(44)24(12)36(28)52-38(48)26-14(2)18(6)30(42)22(10)34(26)46/h41-46H,1-12H3 |
| InChIKey | KETJYQNMUBBNOX-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 208.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.90 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|