C22H40Br2O6Si — CID 11767097
tert-butyl-[(3R,4S)-1,1-dibromo-4-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyhepta-1,6-dien-3-yl]oxy-dimethylsilane (PubChem CID 11767097) has the molecular formula C22H40Br2O6Si and a molecular weight of 588.45 g/mol. Its IUPAC name is tert-butyl-[(3R,4S)-1,1-dibromo-4-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyhepta-1,6-dien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4S)-1,1-dibromo-4-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyhepta-1,6-dien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11767097 |
| Molecular Formula | C22H40Br2O6Si |
| Molecular Weight | 588.45 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | tert-butyl-[(3R,4S)-1,1-dibromo-4-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyhepta-1,6-dien-3-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@H](O[C@@H]1O[C@@H](C)[C@H](OC)[C@@H](OC)[C@H]1OC)[C@@H](C=C(Br)Br)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40Br2O6Si/c1-11-12-15(16(13-17(23)24)30-31(9,10)22(3,4)5)29-21-20(27-8)19(26-7)18(25-6)14(2)28-21/h11,13-16,18-21H,1,12H2,2-10H3/t14-,15-,16+,18-,19+,20+,21-/m0/s1 |
| InChIKey | KXNULOJAKYNQMO-KBONVHAXSA-N |
| XLogP | 5.76 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|