C33H58O7Si — CID 11767143
(1R,3S,4S,10S)-10-[(2R,5R,6S)-5-ethyl-6-methyl-5-triethylsilyloxyoxan-2-yl]-4-[(2S)-1-hydroxybutan-2-yl]-1,3,10-trimethyl-5,7,9-trioxadispiro[5.1.58.26]pentadec-14-en-13-one (PubChem CID 11767143) has the molecular formula C33H58O7Si and a molecular weight of 594.91 g/mol. Its IUPAC name is (1R,3S,4S,10S)-10-[(2R,5R,6S)-5-ethyl-6-methyl-5-triethylsilyloxyoxan-2-yl]-4-[(2S)-1-hydroxybutan-2-yl]-1,3,10-trimethyl-5,7,9-trioxadispiro[5.1.58.26]pentadec-14-en-13-one.
| Compound Name | (1R,3S,4S,10S)-10-[(2R,5R,6S)-5-ethyl-6-methyl-5-triethylsilyloxyoxan-2-yl]-4-[(2S)-1-hydroxybutan-2-yl]-1,3,10-trimethyl-5,7,9-trioxadispiro[5.1.58.26]pentadec-14-en-13-one |
|---|---|
| PubChem CID | 11767143 |
| Molecular Formula | C33H58O7Si |
| Molecular Weight | 594.91 g/mol |
| Exact Mass | 594.40 |
| IUPAC Name | (1R,3S,4S,10S)-10-[(2R,5R,6S)-5-ethyl-6-methyl-5-triethylsilyloxyoxan-2-yl]-4-[(2S)-1-hydroxybutan-2-yl]-1,3,10-trimethyl-5,7,9-trioxadispiro[5.1.58.26]pentadec-14-en-13-one |
| SMILES | CC[C@@H](CO)[C@H]1OC2(C=CC3(O2)O[C@](C)([C@H]2CC[C@@](CC)(O[Si](CC)(CC)CC)[C@H](C)O2)CCC3=O)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C33H58O7Si/c1-10-26(22-34)29-23(6)21-24(7)32(37-29)19-20-33(39-32)27(35)15-17-30(9,38-33)28-16-18-31(11-2,25(8)36-28)40-41(12-3,13-4)14-5/h19-20,23-26,28-29,34H,10-18,21-22H2,1-9H3/t23-,24+,25-,26-,28+,29-,30-,31+,32?,33?/m0/s1 |
| InChIKey | OVXOZAMDLFQNSW-OCNBJUEHSA-N |
| XLogP | 6.92 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.91 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|