C31H31NS6 — CID 11767241
2-[10-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]anthracen-9-ylidene]-5-methyl-[1,3]dithiolo[4,5-c]pyrrole (PubChem CID 11767241) has the molecular formula C31H31NS6 and a molecular weight of 610.00 g/mol. Its IUPAC name is 2-[10-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]anthracen-9-ylidene]-5-methyl-[1,3]dithiolo[4,5-c]pyrrole.
| Compound Name | 2-[10-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]anthracen-9-ylidene]-5-methyl-[1,3]dithiolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 11767241 |
| Molecular Formula | C31H31NS6 |
| Molecular Weight | 610.00 g/mol |
| Exact Mass | 609.08 |
| IUPAC Name | 2-[10-[4,5-bis(butylsulfanyl)-1,3-dithiol-2-ylidene]anthracen-9-ylidene]-5-methyl-[1,3]dithiolo[4,5-c]pyrrole |
| SMILES | CCCCSC1=C(SCCCC)SC(=c2c3ccccc3c(=C3Sc4cn(C)cc4S3)c3ccccc23)S1 |
| InChI | InChI=1S/C31H31NS6/c1-4-6-16-33-30-31(34-17-7-5-2)38-29(37-30)27-22-14-10-8-12-20(22)26(21-13-9-11-15-23(21)27)28-35-24-18-32(3)19-25(24)36-28/h8-15,18-19H,4-7,16-17H2,1-3H3 |
| InChIKey | PYEHORZHBAAPSQ-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.00 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|